C21H23NO2S — CID 45351967
N-ethyl-2-(6-methoxynaphthalen-2-yl)-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 45351967) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is N-ethyl-2-(6-methoxynaphthalen-2-yl)-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | N-ethyl-2-(6-methoxynaphthalen-2-yl)-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 45351967 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-ethyl-2-(6-methoxynaphthalen-2-yl)-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CCN(Cc1cccs1)C(=O)C(C)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C21H23NO2S/c1-4-22(14-20-6-5-11-25-20)21(23)15(2)16-7-8-18-13-19(24-3)10-9-17(18)12-16/h5-13,15H,4,14H2,1-3H3 |
| InChIKey | ZOKBEUMWFKBHDT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |