C18H29N3O4 — CID 45354959
2-[[2-[2-(4-methoxyphenoxy)ethyl-methylamino]acetyl]amino]-N-propylpropanamide (PubChem CID 45354959) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[[2-[2-(4-methoxyphenoxy)ethyl-methylamino]acetyl]amino]-N-propylpropanamide.
| Compound Name | 2-[[2-[2-(4-methoxyphenoxy)ethyl-methylamino]acetyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 45354959 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-[[2-[2-(4-methoxyphenoxy)ethyl-methylamino]acetyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NC(=O)CN(C)CCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H29N3O4/c1-5-10-19-18(23)14(2)20-17(22)13-21(3)11-12-25-16-8-6-15(24-4)7-9-16/h6-9,14H,5,10-13H2,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | URLKVDHERHURHY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |