C20H23ClFN3O — CID 45355486
N-(4-chloro-2-fluorophenyl)-2-(4-piperidin-1-ylanilino)propanamide (PubChem CID 45355486) has the molecular formula C20H23ClFN3O and a molecular weight of 375.88 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(4-piperidin-1-ylanilino)propanamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(4-piperidin-1-ylanilino)propanamide |
|---|---|
| PubChem CID | 45355486 |
| Molecular Formula | C20H23ClFN3O |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(4-piperidin-1-ylanilino)propanamide |
| SMILES | CC(Nc1ccc(N2CCCCC2)cc1)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C20H23ClFN3O/c1-14(20(26)24-19-10-5-15(21)13-18(19)22)23-16-6-8-17(9-7-16)25-11-3-2-4-12-25/h5-10,13-14,23H,2-4,11-12H2,1H3,(H,24,26) |
| InChIKey | WDCZOWVAAXTWSE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|