C10H12Br2O3S — CID 45357999
methyl 7,7-dibromo-3,3-dimethyl-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylate (PubChem CID 45357999) has the molecular formula C10H12Br2O3S and a molecular weight of 372.08 g/mol. Its IUPAC name is methyl 7,7-dibromo-3,3-dimethyl-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylate.
| Compound Name | methyl 7,7-dibromo-3,3-dimethyl-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylate |
|---|---|
| PubChem CID | 45357999 |
| Molecular Formula | C10H12Br2O3S |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.89 |
| IUPAC Name | methyl 7,7-dibromo-3,3-dimethyl-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylate |
| SMILES | COC(=O)C1C2C(=O)C(Br)(Br)C2SC1(C)C |
| InChI | InChI=1S/C10H12Br2O3S/c1-9(2)5(8(14)15-3)4-6(13)10(11,12)7(4)16-9/h4-5,7H,1-3H3 |
| InChIKey | YLDRFALXIKERRY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|