C9H10Br2O5S — CID 71623194
7,7-dibromo-3,3-dimethyl-2,2,6-trioxo-2λ6-thiabicyclo[3.2.0]heptane-4-carboxylic acid (PubChem CID 71623194) has the molecular formula C9H10Br2O5S and a molecular weight of 390.05 g/mol. Its IUPAC name is 7,7-dibromo-3,3-dimethyl-2,2,6-trioxo-2λ6-thiabicyclo[3.2.0]heptane-4-carboxylic acid.
| Compound Name | 7,7-dibromo-3,3-dimethyl-2,2,6-trioxo-2λ6-thiabicyclo[3.2.0]heptane-4-carboxylic acid |
|---|---|
| PubChem CID | 71623194 |
| Molecular Formula | C9H10Br2O5S |
| Molecular Weight | 390.05 g/mol |
| Exact Mass | 387.86 |
| IUPAC Name | 7,7-dibromo-3,3-dimethyl-2,2,6-trioxo-2λ6-thiabicyclo[3.2.0]heptane-4-carboxylic acid |
| SMILES | CC1(C)C(C(=O)O)C2C(=O)C(Br)(Br)C2S1(=O)=O |
| InChI | InChI=1S/C9H10Br2O5S/c1-8(2)4(7(13)14)3-5(12)9(10,11)6(3)17(8,15)16/h3-4,6H,1-2H3,(H,13,14) |
| InChIKey | WCGXPOWEYDTFPA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.05 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|