C20H29NO2 — CID 45359729
(2E,4E)-N-[2-(4-hydroxyphenyl)ethyl]dodeca-2,4-dienamide (PubChem CID 45359729) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (2E,4E)-N-[2-(4-hydroxyphenyl)ethyl]dodeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-[2-(4-hydroxyphenyl)ethyl]dodeca-2,4-dienamide |
|---|---|
| PubChem CID | 45359729 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (2E,4E)-N-[2-(4-hydroxyphenyl)ethyl]dodeca-2,4-dienamide |
| SMILES | CCCCCCC/C=C/C=C/C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C20H29NO2/c1-2-3-4-5-6-7-8-9-10-11-20(23)21-17-16-18-12-14-19(22)15-13-18/h8-15,22H,2-7,16-17H2,1H3,(H,21,23)/b9-8+,11-10+ |
| InChIKey | VVRNYAJXAUQHEN-BNFZFUHLSA-N |
| XLogP | 4.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|