C17H31N3O3 — CID 45360810
methyl 3-[(2S,5aS,8aR)-6-(2,2-dimethylpropyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate (PubChem CID 45360810) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is methyl 3-[(2S,5aS,8aR)-6-(2,2-dimethylpropyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate.
| Compound Name | methyl 3-[(2S,5aS,8aR)-6-(2,2-dimethylpropyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate |
|---|---|
| PubChem CID | 45360810 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | methyl 3-[(2S,5aS,8aR)-6-(2,2-dimethylpropyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CNC(=O)[C@@H]2[C@@H](CCN2CC(C)(C)C)N1C |
| InChI | InChI=1S/C17H31N3O3/c1-17(2,3)11-20-9-8-13-15(20)16(22)18-10-12(19(13)4)6-7-14(21)23-5/h12-13,15H,6-11H2,1-5H3,(H,18,22)/t12-,13+,15-/m0/s1 |
| InChIKey | FEWIKYCBXRZLAQ-GUTXKFCHSA-N |
| XLogP | 0.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |