C20H29N3O3 — CID 163154014
methyl 3-[(2S,5aS,8aS)-1-methyl-6-[(4-methylphenyl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate (PubChem CID 163154014) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is methyl 3-[(2S,5aS,8aS)-1-methyl-6-[(4-methylphenyl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate.
| Compound Name | methyl 3-[(2S,5aS,8aS)-1-methyl-6-[(4-methylphenyl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate |
|---|---|
| PubChem CID | 163154014 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | methyl 3-[(2S,5aS,8aS)-1-methyl-6-[(4-methylphenyl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CNC(=O)[C@@H]2[C@H](CCN2Cc2ccc(C)cc2)N1C |
| InChI | InChI=1S/C20H29N3O3/c1-14-4-6-15(7-5-14)13-23-11-10-17-19(23)20(25)21-12-16(22(17)2)8-9-18(24)26-3/h4-7,16-17,19H,8-13H2,1-3H3,(H,21,25)/t16-,17-,19-/m0/s1 |
| InChIKey | OKLFRQKZEQUZCN-LNLFQRSKSA-N |
| XLogP | 1.32 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |