C25H40N6O2 — CID 163147073
(2R,5aR,8aR)-6-[[4-(dimethylamino)phenyl]methyl]-1-methyl-2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one (PubChem CID 163147073) has the molecular formula C25H40N6O2 and a molecular weight of 456.64 g/mol. Its IUPAC name is (2R,5aR,8aR)-6-[[4-(dimethylamino)phenyl]methyl]-1-methyl-2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | (2R,5aR,8aR)-6-[[4-(dimethylamino)phenyl]methyl]-1-methyl-2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 163147073 |
| Molecular Formula | C25H40N6O2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | (2R,5aR,8aR)-6-[[4-(dimethylamino)phenyl]methyl]-1-methyl-2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
| SMILES | CN1CCN(C(=O)CC[C@@H]2CNC(=O)[C@H]3[C@@H](CCN3Cc3ccc(N(C)C)cc3)N2C)CC1 |
| InChI | InChI=1S/C25H40N6O2/c1-27(2)20-7-5-19(6-8-20)18-31-12-11-22-24(31)25(33)26-17-21(29(22)4)9-10-23(32)30-15-13-28(3)14-16-30/h5-8,21-22,24H,9-18H2,1-4H3,(H,26,33)/t21-,22-,24-/m1/s1 |
| InChIKey | LZHMXXSDOCHTLX-CQOQZXRMSA-N |
| XLogP | 0.68 |
| TPSA | 62.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|