C25H35N5O3 — CID 75111621
3-[6-[[4-(dimethylamino)phenyl]methyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(furan-2-ylmethyl)propanamide (PubChem CID 75111621) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 3-[6-[[4-(dimethylamino)phenyl]methyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 3-[6-[[4-(dimethylamino)phenyl]methyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 75111621 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 3-[6-[[4-(dimethylamino)phenyl]methyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(furan-2-ylmethyl)propanamide |
| SMILES | CN(C)c1ccc(CN2CCC3C2C(=O)NCC(CCC(=O)NCc2ccco2)N3C)cc1 |
| InChI | InChI=1S/C25H35N5O3/c1-28(2)19-8-6-18(7-9-19)17-30-13-12-22-24(30)25(32)27-15-20(29(22)3)10-11-23(31)26-16-21-5-4-14-33-21/h4-9,14,20,22,24H,10-13,15-17H2,1-3H3,(H,26,31)(H,27,32) |
| InChIKey | NPTPCJUEHJZPLO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|