C22H30N4O4S — CID 75111589
3-[1-methyl-6-[(4-methylsulfonylphenyl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-prop-2-ynylpropanamide (PubChem CID 75111589) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is 3-[1-methyl-6-[(4-methylsulfonylphenyl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-prop-2-ynylpropanamide.
| Compound Name | 3-[1-methyl-6-[(4-methylsulfonylphenyl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 75111589 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-[1-methyl-6-[(4-methylsulfonylphenyl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)CCC1CNC(=O)C2C(CCN2Cc2ccc(S(C)(=O)=O)cc2)N1C |
| InChI | InChI=1S/C22H30N4O4S/c1-4-12-23-20(27)10-7-17-14-24-22(28)21-19(25(17)2)11-13-26(21)15-16-5-8-18(9-6-16)31(3,29)30/h1,5-6,8-9,17,19,21H,7,10-15H2,2-3H3,(H,23,27)(H,24,28) |
| InChIKey | OARGWYXTCAJGMT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|