C24H30N4O5 — CID 75111635
4-[[2-[3-(furan-2-ylmethylamino)-3-oxopropyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-6-yl]methyl]benzoic acid (PubChem CID 75111635) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-[[2-[3-(furan-2-ylmethylamino)-3-oxopropyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-6-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-[3-(furan-2-ylmethylamino)-3-oxopropyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-6-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 75111635 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 4-[[2-[3-(furan-2-ylmethylamino)-3-oxopropyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-6-yl]methyl]benzoic acid |
| SMILES | CN1C(CCC(=O)NCc2ccco2)CNC(=O)C2C1CCN2Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H30N4O5/c1-27-18(8-9-21(29)25-14-19-3-2-12-33-19)13-26-23(30)22-20(27)10-11-28(22)15-16-4-6-17(7-5-16)24(31)32/h2-7,12,18,20,22H,8-11,13-15H2,1H3,(H,25,29)(H,26,30)(H,31,32) |
| InChIKey | QLJHHZSXFXCBGF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |