C26H33N5O3 — CID 75111618
N-(furan-2-ylmethyl)-3-[1-methyl-6-[(1-methylindol-3-yl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide (PubChem CID 75111618) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[1-methyl-6-[(1-methylindol-3-yl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[1-methyl-6-[(1-methylindol-3-yl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide |
|---|---|
| PubChem CID | 75111618 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[1-methyl-6-[(1-methylindol-3-yl)methyl]-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide |
| SMILES | CN1C(CCC(=O)NCc2ccco2)CNC(=O)C2C1CCN2Cc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C26H33N5O3/c1-29-16-18(21-7-3-4-8-22(21)29)17-31-12-11-23-25(31)26(33)28-14-19(30(23)2)9-10-24(32)27-15-20-6-5-13-34-20/h3-8,13,16,19,23,25H,9-12,14-15,17H2,1-2H3,(H,27,32)(H,28,33) |
| InChIKey | SXEBZQDGUCVUFZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |