C19H26N6O3S — CID 75111636
N-(furan-2-ylmethyl)-3-[1-methyl-5-oxo-6-(thiadiazol-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide (PubChem CID 75111636) has the molecular formula C19H26N6O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[1-methyl-5-oxo-6-(thiadiazol-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[1-methyl-5-oxo-6-(thiadiazol-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide |
|---|---|
| PubChem CID | 75111636 |
| Molecular Formula | C19H26N6O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[1-methyl-5-oxo-6-(thiadiazol-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide |
| SMILES | CN1C(CCC(=O)NCc2ccco2)CNC(=O)C2C1CCN2Cc1csnn1 |
| InChI | InChI=1S/C19H26N6O3S/c1-24-14(4-5-17(26)20-10-15-3-2-8-28-15)9-21-19(27)18-16(24)6-7-25(18)11-13-12-29-23-22-13/h2-3,8,12,14,16,18H,4-7,9-11H2,1H3,(H,20,26)(H,21,27) |
| InChIKey | KLQSRJYHONSNSU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |