C20H30N4O2S — CID 45361023
3-[(2S,5aS,8aR)-6-(cyclopropylmethyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 45361023) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is 3-[(2S,5aS,8aR)-6-(cyclopropylmethyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-[(2S,5aS,8aR)-6-(cyclopropylmethyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 45361023 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 3-[(2S,5aS,8aR)-6-(cyclopropylmethyl)-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CN1[C@@H](CCC(=O)NCc2cccs2)CNC(=O)[C@@H]2[C@H]1CCN2CC1CC1 |
| InChI | InChI=1S/C20H30N4O2S/c1-23-15(6-7-18(25)21-12-16-3-2-10-27-16)11-22-20(26)19-17(23)8-9-24(19)13-14-4-5-14/h2-3,10,14-15,17,19H,4-9,11-13H2,1H3,(H,21,25)(H,22,26)/t15-,17+,19-/m0/s1 |
| InChIKey | XRCMWSSYRWVHIY-WDYCEAGBSA-N |
| XLogP | 1.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |