C16H24N4O2S — CID 75111789
3-(1-methyl-5-oxo-2,3,4,5a,6,7,8,8a-octahydropyrrolo[3,2-e][1,4]diazepin-2-yl)-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 75111789) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 3-(1-methyl-5-oxo-2,3,4,5a,6,7,8,8a-octahydropyrrolo[3,2-e][1,4]diazepin-2-yl)-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(1-methyl-5-oxo-2,3,4,5a,6,7,8,8a-octahydropyrrolo[3,2-e][1,4]diazepin-2-yl)-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 75111789 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-(1-methyl-5-oxo-2,3,4,5a,6,7,8,8a-octahydropyrrolo[3,2-e][1,4]diazepin-2-yl)-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CN1C(CCC(=O)NCc2cccs2)CNC(=O)C2NCCC21 |
| InChI | InChI=1S/C16H24N4O2S/c1-20-11(9-19-16(22)15-13(20)6-7-17-15)4-5-14(21)18-10-12-3-2-8-23-12/h2-3,8,11,13,15,17H,4-7,9-10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | JNHWHXJFEGEKFE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |