C21H25FN4O4S2 — CID 25339188
3-[(4R,7S,8aS)-7-[(4-fluorophenyl)sulfonylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 25339188) has the molecular formula C21H25FN4O4S2 and a molecular weight of 480.59 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-7-[(4-fluorophenyl)sulfonylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-[(4R,7S,8aS)-7-[(4-fluorophenyl)sulfonylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 25339188 |
| Molecular Formula | C21H25FN4O4S2 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 3-[(4R,7S,8aS)-7-[(4-fluorophenyl)sulfonylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | O=C(CC[C@@H]1CNC(=O)[C@@H]2C[C@H](NS(=O)(=O)c3ccc(F)cc3)CN12)NCc1cccs1 |
| InChI | InChI=1S/C21H25FN4O4S2/c22-14-3-6-18(7-4-14)32(29,30)25-15-10-19-21(28)24-11-16(26(19)13-15)5-8-20(27)23-12-17-2-1-9-31-17/h1-4,6-7,9,15-16,19,25H,5,8,10-13H2,(H,23,27)(H,24,28)/t15-,16+,19-/m0/s1 |
| InChIKey | WFKIEZFWUFCBTE-FCEWJHQRSA-N |
| XLogP | 1.20 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |