C19H24N4O4S3 — CID 25339186
3-[(4R,7S,8aS)-1-oxo-7-(thiophen-2-ylsulfonylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 25339186) has the molecular formula C19H24N4O4S3 and a molecular weight of 468.63 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-1-oxo-7-(thiophen-2-ylsulfonylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-[(4R,7S,8aS)-1-oxo-7-(thiophen-2-ylsulfonylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 25339186 |
| Molecular Formula | C19H24N4O4S3 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 3-[(4R,7S,8aS)-1-oxo-7-(thiophen-2-ylsulfonylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | O=C(CC[C@@H]1CNC(=O)[C@@H]2C[C@H](NS(=O)(=O)c3cccs3)CN12)NCc1cccs1 |
| InChI | InChI=1S/C19H24N4O4S3/c24-17(20-11-15-3-1-7-28-15)6-5-14-10-21-19(25)16-9-13(12-23(14)16)22-30(26,27)18-4-2-8-29-18/h1-4,7-8,13-14,16,22H,5-6,9-12H2,(H,20,24)(H,21,25)/t13-,14+,16-/m0/s1 |
| InChIKey | XHDHJVOPBAEJGU-LZWOXQAQSA-N |
| XLogP | 1.13 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |