C23H29N5O3S2 — CID 74508841
3-[7-[(4-methoxyphenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 74508841) has the molecular formula C23H29N5O3S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 3-[7-[(4-methoxyphenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-[7-[(4-methoxyphenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 74508841 |
| Molecular Formula | C23H29N5O3S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 3-[7-[(4-methoxyphenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | COc1ccc(NC(=S)NC2CC3C(=O)NCC(CCC(=O)NCc4cccs4)N3C2)cc1 |
| InChI | InChI=1S/C23H29N5O3S2/c1-31-18-7-4-15(5-8-18)26-23(32)27-16-11-20-22(30)25-12-17(28(20)14-16)6-9-21(29)24-13-19-3-2-10-33-19/h2-5,7-8,10,16-17,20H,6,9,11-14H2,1H3,(H,24,29)(H,25,30)(H2,26,27,32) |
| InChIKey | QCNNMTMHOUZJIA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|