C21H28ClN5O2S — CID 162796573
1-[(4R,7R,8aS)-1-oxo-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)thiourea (PubChem CID 162796573) has the molecular formula C21H28ClN5O2S and a molecular weight of 450.01 g/mol. Its IUPAC name is 1-[(4R,7R,8aS)-1-oxo-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[(4R,7R,8aS)-1-oxo-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 162796573 |
| Molecular Formula | C21H28ClN5O2S |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-[(4R,7R,8aS)-1-oxo-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)thiourea |
| SMILES | O=C1NC[C@@H](CCC(=O)N2CCCC2)N2C[C@H](NC(=S)Nc3ccc(Cl)cc3)C[C@@H]12 |
| InChI | InChI=1S/C21H28ClN5O2S/c22-14-3-5-15(6-4-14)24-21(30)25-16-11-18-20(29)23-12-17(27(18)13-16)7-8-19(28)26-9-1-2-10-26/h3-6,16-18H,1-2,7-13H2,(H,23,29)(H2,24,25,30)/t16-,17-,18+/m1/s1 |
| InChIKey | MEOGTXDQVOTWNY-KURKYZTESA-N |
| XLogP | 1.97 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|