C20H25N5O2S — CID 26762890
3-[(4R,7S,8aS)-1-oxo-7-(phenylcarbamothioylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-prop-2-ynylpropanamide (PubChem CID 26762890) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-1-oxo-7-(phenylcarbamothioylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-prop-2-ynylpropanamide.
| Compound Name | 3-[(4R,7S,8aS)-1-oxo-7-(phenylcarbamothioylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 26762890 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-[(4R,7S,8aS)-1-oxo-7-(phenylcarbamothioylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)CC[C@@H]1CNC(=O)[C@@H]2C[C@H](NC(=S)Nc3ccccc3)CN12 |
| InChI | InChI=1S/C20H25N5O2S/c1-2-10-21-18(26)9-8-16-12-22-19(27)17-11-15(13-25(16)17)24-20(28)23-14-6-4-3-5-7-14/h1,3-7,15-17H,8-13H2,(H,21,26)(H,22,27)(H2,23,24,28)/t15-,16+,17-/m0/s1 |
| InChIKey | NTKDWQMSROQVKE-BBWFWOEESA-N |
| XLogP | 0.44 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|