C22H30ClN5O2S — CID 26762979
1-[(4R,7S,8aS)-1-oxo-4-(3-oxo-3-piperidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)thiourea (PubChem CID 26762979) has the molecular formula C22H30ClN5O2S and a molecular weight of 464.04 g/mol. Its IUPAC name is 1-[(4R,7S,8aS)-1-oxo-4-(3-oxo-3-piperidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[(4R,7S,8aS)-1-oxo-4-(3-oxo-3-piperidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 26762979 |
| Molecular Formula | C22H30ClN5O2S |
| Molecular Weight | 464.04 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 1-[(4R,7S,8aS)-1-oxo-4-(3-oxo-3-piperidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(4-chlorophenyl)thiourea |
| SMILES | O=C1NC[C@@H](CCC(=O)N2CCCCC2)N2C[C@@H](NC(=S)Nc3ccc(Cl)cc3)C[C@@H]12 |
| InChI | InChI=1S/C22H30ClN5O2S/c23-15-4-6-16(7-5-15)25-22(31)26-17-12-19-21(30)24-13-18(28(19)14-17)8-9-20(29)27-10-2-1-3-11-27/h4-7,17-19H,1-3,8-14H2,(H,24,30)(H2,25,26,31)/t17-,18+,19-/m0/s1 |
| InChIKey | NWSRXNAXTNIMMD-OTWHNJEPSA-N |
| XLogP | 2.36 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.04 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|