C21H29N5O3 — CID 163138905
1-[(4R,7R,8aS)-1-oxo-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-phenylurea (PubChem CID 163138905) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-[(4R,7R,8aS)-1-oxo-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-phenylurea.
| Compound Name | 1-[(4R,7R,8aS)-1-oxo-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-phenylurea |
|---|---|
| PubChem CID | 163138905 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 1-[(4R,7R,8aS)-1-oxo-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@@H]1C[C@H]2C(=O)NC[C@@H](CCC(=O)N3CCCC3)N2C1 |
| InChI | InChI=1S/C21H29N5O3/c27-19(25-10-4-5-11-25)9-8-17-13-22-20(28)18-12-16(14-26(17)18)24-21(29)23-15-6-2-1-3-7-15/h1-3,6-7,16-18H,4-5,8-14H2,(H,22,28)(H2,23,24,29)/t16-,17-,18+/m1/s1 |
| InChIKey | JAGVEXKCLWMKKL-KURKYZTESA-N |
| XLogP | 1.15 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |