C23H35N5O2 — CID 75111431
7-[[4-(dimethylamino)phenyl]methylamino]-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 75111431) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 7-[[4-(dimethylamino)phenyl]methylamino]-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | 7-[[4-(dimethylamino)phenyl]methylamino]-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 75111431 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 7-[[4-(dimethylamino)phenyl]methylamino]-4-(3-oxo-3-pyrrolidin-1-ylpropyl)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | CN(C)c1ccc(CNC2CC3C(=O)NCC(CCC(=O)N4CCCC4)N3C2)cc1 |
| InChI | InChI=1S/C23H35N5O2/c1-26(2)19-7-5-17(6-8-19)14-24-18-13-21-23(30)25-15-20(28(21)16-18)9-10-22(29)27-11-3-4-12-27/h5-8,18,20-21,24H,3-4,9-16H2,1-2H3,(H,25,30) |
| InChIKey | DEVQMOUKTGKQFI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|