C23H37N5O2 — CID 75111543
3-[7-[[4-(dimethylamino)phenyl]methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide (PubChem CID 75111543) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 3-[7-[[4-(dimethylamino)phenyl]methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide.
| Compound Name | 3-[7-[[4-(dimethylamino)phenyl]methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 75111543 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 3-[7-[[4-(dimethylamino)phenyl]methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCC1CNC(=O)C2CC(NCc3ccc(N(C)C)cc3)CN12 |
| InChI | InChI=1S/C23H37N5O2/c1-5-27(6-2)22(29)12-11-20-15-25-23(30)21-13-18(16-28(20)21)24-14-17-7-9-19(10-8-17)26(3)4/h7-10,18,20-21,24H,5-6,11-16H2,1-4H3,(H,25,30) |
| InChIKey | HBRPHZGSUJGYHX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|