C25H32N6O3 — CID 74508787
4-(dimethylamino)-N-[1-oxo-4-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]benzamide (PubChem CID 74508787) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[1-oxo-4-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[1-oxo-4-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]benzamide |
|---|---|
| PubChem CID | 74508787 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 4-(dimethylamino)-N-[1-oxo-4-[3-oxo-3-(pyridin-3-ylmethylamino)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)NC2CC3C(=O)NCC(CCC(=O)NCc4cccnc4)N3C2)cc1 |
| InChI | InChI=1S/C25H32N6O3/c1-30(2)20-7-5-18(6-8-20)24(33)29-19-12-22-25(34)28-15-21(31(22)16-19)9-10-23(32)27-14-17-4-3-11-26-13-17/h3-8,11,13,19,21-22H,9-10,12,14-16H2,1-2H3,(H,27,32)(H,28,34)(H,29,33) |
| InChIKey | PHTZHPFFYQLJFR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |