C24H30N6O3S — CID 25317694
3-[(4R,7S,8aS)-7-[(3-methylsulfanylphenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 25317694) has the molecular formula C24H30N6O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-7-[(3-methylsulfanylphenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[(4R,7S,8aS)-7-[(3-methylsulfanylphenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 25317694 |
| Molecular Formula | C24H30N6O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 3-[(4R,7S,8aS)-7-[(3-methylsulfanylphenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | CSc1cccc(NC(=O)N[C@H]2C[C@H]3C(=O)NC[C@@H](CCC(=O)NCc4cccnc4)N3C2)c1 |
| InChI | InChI=1S/C24H30N6O3S/c1-34-20-6-2-5-17(10-20)28-24(33)29-18-11-21-23(32)27-14-19(30(21)15-18)7-8-22(31)26-13-16-4-3-9-25-12-16/h2-6,9-10,12,18-19,21H,7-8,11,13-15H2,1H3,(H,26,31)(H,27,32)(H2,28,29,33)/t18-,19+,21-/m0/s1 |
| InChIKey | XGFMPPHRKZQJEB-ZVDOUQERSA-N |
| XLogP | 1.96 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |