C20H27F2N5O3 — CID 74508599
3-[7-[(2,4-difluorophenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide (PubChem CID 74508599) has the molecular formula C20H27F2N5O3 and a molecular weight of 423.46 g/mol. Its IUPAC name is 3-[7-[(2,4-difluorophenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide.
| Compound Name | 3-[7-[(2,4-difluorophenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 74508599 |
| Molecular Formula | C20H27F2N5O3 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 3-[7-[(2,4-difluorophenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCC1CNC(=O)C2CC(NC(=O)Nc3ccc(F)cc3F)CN12 |
| InChI | InChI=1S/C20H27F2N5O3/c1-11(2)24-18(28)6-4-14-9-23-19(29)17-8-13(10-27(14)17)25-20(30)26-16-5-3-12(21)7-15(16)22/h3,5,7,11,13-14,17H,4,6,8-10H2,1-2H3,(H,23,29)(H,24,28)(H2,25,26,30) |
| InChIKey | JDWHINBFGZSADA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |