C21H27F2N5O4 — CID 74508928
1-(2,4-difluorophenyl)-3-[4-(3-morpholin-4-yl-3-oxopropyl)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]urea (PubChem CID 74508928) has the molecular formula C21H27F2N5O4 and a molecular weight of 451.47 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[4-(3-morpholin-4-yl-3-oxopropyl)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[4-(3-morpholin-4-yl-3-oxopropyl)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]urea |
|---|---|
| PubChem CID | 74508928 |
| Molecular Formula | C21H27F2N5O4 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[4-(3-morpholin-4-yl-3-oxopropyl)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]urea |
| SMILES | O=C(Nc1ccc(F)cc1F)NC1CC2C(=O)NCC(CCC(=O)N3CCOCC3)N2C1 |
| InChI | InChI=1S/C21H27F2N5O4/c22-13-1-3-17(16(23)9-13)26-21(31)25-14-10-18-20(30)24-11-15(28(18)12-14)2-4-19(29)27-5-7-32-8-6-27/h1,3,9,14-15,18H,2,4-8,10-12H2,(H,24,30)(H2,25,26,31) |
| InChIKey | WMYGKKWOROJCRV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |