C23H22F2N6O3 — CID 172884333
1-[(4R,7S,8aS)-4-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(2-fluorophenyl)urea (PubChem CID 172884333) has the molecular formula C23H22F2N6O3 and a molecular weight of 468.46 g/mol. Its IUPAC name is 1-[(4R,7S,8aS)-4-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[(4R,7S,8aS)-4-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 172884333 |
| Molecular Formula | C23H22F2N6O3 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-[(4R,7S,8aS)-4-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(2-fluorophenyl)urea |
| SMILES | O=C(Nc1ccccc1F)N[C@H]1C[C@H]2C(=O)NC[C@@H](Cc3nnc(-c4ccccc4F)o3)N2C1 |
| InChI | InChI=1S/C23H22F2N6O3/c24-16-6-2-1-5-15(16)22-30-29-20(34-22)10-14-11-26-21(32)19-9-13(12-31(14)19)27-23(33)28-18-8-4-3-7-17(18)25/h1-8,13-14,19H,9-12H2,(H,26,32)(H2,27,28,33)/t13-,14+,19-/m0/s1 |
| InChIKey | JQMRKDCRHCEGCN-KSMMKXTCSA-N |
| XLogP | 2.32 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |