C18H23N5O2 — CID 172884266
(4R,7S,8aS)-7-(dimethylamino)-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 172884266) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (4R,7S,8aS)-7-(dimethylamino)-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | (4R,7S,8aS)-7-(dimethylamino)-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 172884266 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (4R,7S,8aS)-7-(dimethylamino)-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | CN(C)[C@H]1C[C@H]2C(=O)NC[C@@H](Cc3nnc(-c4ccccc4)o3)N2C1 |
| InChI | InChI=1S/C18H23N5O2/c1-22(2)14-8-15-17(24)19-10-13(23(15)11-14)9-16-20-21-18(25-16)12-6-4-3-5-7-12/h3-7,13-15H,8-11H2,1-2H3,(H,19,24)/t13-,14+,15+/m1/s1 |
| InChIKey | RVVLIAJJTPTUON-ILXRZTDVSA-N |
| XLogP | 0.78 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |