C22H29N5O4 — CID 172884398
(4R,7S,8aS)-4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-7-(oxan-4-ylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 172884398) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is (4R,7S,8aS)-4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-7-(oxan-4-ylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | (4R,7S,8aS)-4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-7-(oxan-4-ylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 172884398 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (4R,7S,8aS)-4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-7-(oxan-4-ylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | COc1ccc(-c2nnc(C[C@@H]3CNC(=O)[C@@H]4C[C@H](NC5CCOCC5)CN34)o2)cc1 |
| InChI | InChI=1S/C22H29N5O4/c1-29-18-4-2-14(3-5-18)22-26-25-20(31-22)11-17-12-23-21(28)19-10-16(13-27(17)19)24-15-6-8-30-9-7-15/h2-5,15-17,19,24H,6-13H2,1H3,(H,23,28)/t16-,17+,19-/m0/s1 |
| InChIKey | UPKOLDIYVFCDRL-SCTDSRPQSA-N |
| XLogP | 1.00 |
| TPSA | 101.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |