C23H28FN5O2 — CID 45360649
3-[(4R,7S,8aS)-1-oxo-7-(pyridin-2-ylmethylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 45360649) has the molecular formula C23H28FN5O2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-1-oxo-7-(pyridin-2-ylmethylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-fluorophenyl)methyl]propanamide.
| Compound Name | 3-[(4R,7S,8aS)-1-oxo-7-(pyridin-2-ylmethylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 45360649 |
| Molecular Formula | C23H28FN5O2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 3-[(4R,7S,8aS)-1-oxo-7-(pyridin-2-ylmethylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | O=C(CC[C@@H]1CNC(=O)[C@@H]2C[C@H](NCc3ccccn3)CN12)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H28FN5O2/c24-17-6-4-16(5-7-17)12-27-22(30)9-8-20-14-28-23(31)21-11-19(15-29(20)21)26-13-18-3-1-2-10-25-18/h1-7,10,19-21,26H,8-9,11-15H2,(H,27,30)(H,28,31)/t19-,20+,21-/m0/s1 |
| InChIKey | VSAYKOZSSJTVIK-HBMCJLEFSA-N |
| XLogP | 1.35 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |