C27H32FN5O2 — CID 162908682
3-[(4R,7R,8aR)-7-[(1-methylindol-3-yl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 162908682) has the molecular formula C27H32FN5O2 and a molecular weight of 477.58 g/mol. Its IUPAC name is 3-[(4R,7R,8aR)-7-[(1-methylindol-3-yl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-fluorophenyl)methyl]propanamide.
| Compound Name | 3-[(4R,7R,8aR)-7-[(1-methylindol-3-yl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 162908682 |
| Molecular Formula | C27H32FN5O2 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 3-[(4R,7R,8aR)-7-[(1-methylindol-3-yl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | Cn1cc(CN[C@@H]2C[C@@H]3C(=O)NC[C@@H](CCC(=O)NCc4ccc(F)cc4)N3C2)c2ccccc21 |
| InChI | InChI=1S/C27H32FN5O2/c1-32-16-19(23-4-2-3-5-24(23)32)14-29-21-12-25-27(35)31-15-22(33(25)17-21)10-11-26(34)30-13-18-6-8-20(28)9-7-18/h2-9,16,21-22,25,29H,10-15,17H2,1H3,(H,30,34)(H,31,35)/t21-,22-,25-/m1/s1 |
| InChIKey | WWAYTEOJYGTRDF-TZBSWOFLSA-N |
| XLogP | 2.44 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |