C18H26N4O4S — CID 163183283
3-[(4R,7R,8aS)-7-(methanesulfonamido)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-benzylpropanamide (PubChem CID 163183283) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 3-[(4R,7R,8aS)-7-(methanesulfonamido)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-benzylpropanamide.
| Compound Name | 3-[(4R,7R,8aS)-7-(methanesulfonamido)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-benzylpropanamide |
|---|---|
| PubChem CID | 163183283 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-[(4R,7R,8aS)-7-(methanesulfonamido)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-benzylpropanamide |
| SMILES | CS(=O)(=O)N[C@@H]1C[C@H]2C(=O)NC[C@@H](CCC(=O)NCc3ccccc3)N2C1 |
| InChI | InChI=1S/C18H26N4O4S/c1-27(25,26)21-14-9-16-18(24)20-11-15(22(16)12-14)7-8-17(23)19-10-13-5-3-2-4-6-13/h2-6,14-16,21H,7-12H2,1H3,(H,19,23)(H,20,24)/t14-,15-,16+/m1/s1 |
| InChIKey | ZZQQMFOPFNNQHF-OAGGEKHMSA-N |
| XLogP | -0.43 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |