C23H30N4O4 — CID 75111459
N-benzyl-3-[7-[[5-(hydroxymethyl)furan-2-yl]methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]propanamide (PubChem CID 75111459) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-benzyl-3-[7-[[5-(hydroxymethyl)furan-2-yl]methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]propanamide.
| Compound Name | N-benzyl-3-[7-[[5-(hydroxymethyl)furan-2-yl]methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]propanamide |
|---|---|
| PubChem CID | 75111459 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-benzyl-3-[7-[[5-(hydroxymethyl)furan-2-yl]methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]propanamide |
| SMILES | O=C(CCC1CNC(=O)C2CC(NCc3ccc(CO)o3)CN12)NCc1ccccc1 |
| InChI | InChI=1S/C23H30N4O4/c28-15-20-8-7-19(31-20)13-24-17-10-21-23(30)26-12-18(27(21)14-17)6-9-22(29)25-11-16-4-2-1-3-5-16/h1-5,7-8,17-18,21,24,28H,6,9-15H2,(H,25,29)(H,26,30) |
| InChIKey | QDKSRJDHSCPBLQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |