C25H31FN4O3 — CID 75111454
3-[7-[(4-fluorophenyl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 75111454) has the molecular formula C25H31FN4O3 and a molecular weight of 454.55 g/mol. Its IUPAC name is 3-[7-[(4-fluorophenyl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-[7-[(4-fluorophenyl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 75111454 |
| Molecular Formula | C25H31FN4O3 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 3-[7-[(4-fluorophenyl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)CCC2CNC(=O)C3CC(NCc4ccc(F)cc4)CN23)cc1 |
| InChI | InChI=1S/C25H31FN4O3/c1-33-22-9-4-18(5-10-22)14-28-24(31)11-8-21-15-29-25(32)23-12-20(16-30(21)23)27-13-17-2-6-19(26)7-3-17/h2-7,9-10,20-21,23,27H,8,11-16H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | GLLNNGRDHVIGFK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |