C22H31F3N4O3 — CID 45360759
3-[(4R,7S,8aS)-1-oxo-7-[[4-(trifluoromethoxy)phenyl]methylamino]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide (PubChem CID 45360759) has the molecular formula C22H31F3N4O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-1-oxo-7-[[4-(trifluoromethoxy)phenyl]methylamino]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide.
| Compound Name | 3-[(4R,7S,8aS)-1-oxo-7-[[4-(trifluoromethoxy)phenyl]methylamino]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 45360759 |
| Molecular Formula | C22H31F3N4O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3-[(4R,7S,8aS)-1-oxo-7-[[4-(trifluoromethoxy)phenyl]methylamino]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CC[C@@H]1CNC(=O)[C@@H]2C[C@H](NCc3ccc(OC(F)(F)F)cc3)CN12 |
| InChI | InChI=1S/C22H31F3N4O3/c1-3-28(4-2)20(30)10-7-17-13-27-21(31)19-11-16(14-29(17)19)26-12-15-5-8-18(9-6-15)32-22(23,24)25/h5-6,8-9,16-17,19,26H,3-4,7,10-14H2,1-2H3,(H,27,31)/t16-,17+,19-/m0/s1 |
| InChIKey | HMCHCROTZSEDDY-SCTDSRPQSA-N |
| XLogP | 2.26 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |