C22H33N5O3S — CID 74509107
N,N-diethyl-3-[7-[(4-methoxyphenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]propanamide (PubChem CID 74509107) has the molecular formula C22H33N5O3S and a molecular weight of 447.61 g/mol. Its IUPAC name is N,N-diethyl-3-[7-[(4-methoxyphenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]propanamide.
| Compound Name | N,N-diethyl-3-[7-[(4-methoxyphenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]propanamide |
|---|---|
| PubChem CID | 74509107 |
| Molecular Formula | C22H33N5O3S |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N,N-diethyl-3-[7-[(4-methoxyphenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]propanamide |
| SMILES | CCN(CC)C(=O)CCC1CNC(=O)C2CC(NC(=S)Nc3ccc(OC)cc3)CN12 |
| InChI | InChI=1S/C22H33N5O3S/c1-4-26(5-2)20(28)11-8-17-13-23-21(29)19-12-16(14-27(17)19)25-22(31)24-15-6-9-18(30-3)10-7-15/h6-7,9-10,16-17,19H,4-5,8,11-14H2,1-3H3,(H,23,29)(H2,24,25,31) |
| InChIKey | RHKKFTLRIDQKOJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|