C20H28ClN5O2S — CID 26762104
3-[(4R,7S,8aS)-7-[(4-chlorophenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide (PubChem CID 26762104) has the molecular formula C20H28ClN5O2S and a molecular weight of 438.00 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-7-[(4-chlorophenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide.
| Compound Name | 3-[(4R,7S,8aS)-7-[(4-chlorophenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 26762104 |
| Molecular Formula | C20H28ClN5O2S |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-[(4R,7S,8aS)-7-[(4-chlorophenyl)carbamothioylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CC[C@@H]1CNC(=O)[C@@H]2C[C@H](NC(=S)Nc3ccc(Cl)cc3)CN12 |
| InChI | InChI=1S/C20H28ClN5O2S/c1-12(2)23-18(27)8-7-16-10-22-19(28)17-9-15(11-26(16)17)25-20(29)24-14-5-3-13(21)4-6-14/h3-6,12,15-17H,7-11H2,1-2H3,(H,22,28)(H,23,27)(H2,24,25,29)/t15-,16+,17-/m0/s1 |
| InChIKey | FNECYPYIJITHPV-BBWFWOEESA-N |
| XLogP | 1.87 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|