C22H30N6O3S — CID 75111726
N-[(4-methoxyphenyl)methyl]-3-[1-methyl-5-oxo-6-(thiadiazol-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide (PubChem CID 75111726) has the molecular formula C22H30N6O3S and a molecular weight of 458.59 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-3-[1-methyl-5-oxo-6-(thiadiazol-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-3-[1-methyl-5-oxo-6-(thiadiazol-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide |
|---|---|
| PubChem CID | 75111726 |
| Molecular Formula | C22H30N6O3S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-3-[1-methyl-5-oxo-6-(thiadiazol-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanamide |
| SMILES | COc1ccc(CNC(=O)CCC2CNC(=O)C3C(CCN3Cc3csnn3)N2C)cc1 |
| InChI | InChI=1S/C22H30N6O3S/c1-27-17(5-8-20(29)23-11-15-3-6-18(31-2)7-4-15)12-24-22(30)21-19(27)9-10-28(21)13-16-14-32-26-25-16/h3-4,6-7,14,17,19,21H,5,8-13H2,1-2H3,(H,23,29)(H,24,30) |
| InChIKey | VUZZUISMCRILJW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |