C23H34ClN5O2 — CID 75111919
6-[(3-chlorophenyl)methyl]-1-methyl-2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one (PubChem CID 75111919) has the molecular formula C23H34ClN5O2 and a molecular weight of 448.01 g/mol. Its IUPAC name is 6-[(3-chlorophenyl)methyl]-1-methyl-2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | 6-[(3-chlorophenyl)methyl]-1-methyl-2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 75111919 |
| Molecular Formula | C23H34ClN5O2 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 6-[(3-chlorophenyl)methyl]-1-methyl-2-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
| SMILES | CN1CCN(C(=O)CCC2CNC(=O)C3C(CCN3Cc3cccc(Cl)c3)N2C)CC1 |
| InChI | InChI=1S/C23H34ClN5O2/c1-26-10-12-28(13-11-26)21(30)7-6-19-15-25-23(31)22-20(27(19)2)8-9-29(22)16-17-4-3-5-18(24)14-17/h3-5,14,19-20,22H,6-13,15-16H2,1-2H3,(H,25,31) |
| InChIKey | YYQIPOICWVVSBO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |