C24H30ClN5O2 — CID 162798433
3-[(2S,5aS,8aS)-6-[(3-chlorophenyl)methyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 162798433) has the molecular formula C24H30ClN5O2 and a molecular weight of 455.99 g/mol. Its IUPAC name is 3-[(2S,5aS,8aS)-6-[(3-chlorophenyl)methyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[(2S,5aS,8aS)-6-[(3-chlorophenyl)methyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 162798433 |
| Molecular Formula | C24H30ClN5O2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 3-[(2S,5aS,8aS)-6-[(3-chlorophenyl)methyl]-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | CN1[C@@H](CCC(=O)NCc2cccnc2)CNC(=O)[C@@H]2[C@@H]1CCN2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H30ClN5O2/c1-29-20(7-8-22(31)27-14-18-5-3-10-26-13-18)15-28-24(32)23-21(29)9-11-30(23)16-17-4-2-6-19(25)12-17/h2-6,10,12-13,20-21,23H,7-9,11,14-16H2,1H3,(H,27,31)(H,28,32)/t20-,21-,23-/m0/s1 |
| InChIKey | LXMTYRAJKYUMET-FUDKSRODSA-N |
| XLogP | 2.20 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |