C23H36N6O2 — CID 75111772
3-[1-methyl-6-(1-methylpiperidin-4-yl)-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 75111772) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 3-[1-methyl-6-(1-methylpiperidin-4-yl)-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[1-methyl-6-(1-methylpiperidin-4-yl)-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 75111772 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 3-[1-methyl-6-(1-methylpiperidin-4-yl)-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | CN1CCC(N2CCC3C2C(=O)NCC(CCC(=O)NCc2cccnc2)N3C)CC1 |
| InChI | InChI=1S/C23H36N6O2/c1-27-11-7-18(8-12-27)29-13-9-20-22(29)23(31)26-16-19(28(20)2)5-6-21(30)25-15-17-4-3-10-24-14-17/h3-4,10,14,18-20,22H,5-9,11-13,15-16H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | SLCHAWJQGTWCRY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |