C23H34N4O2 — CID 163050323
3-[(2S,5aS,8aS)-6-cyclohexyl-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-phenylpropanamide (PubChem CID 163050323) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 3-[(2S,5aS,8aS)-6-cyclohexyl-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-phenylpropanamide.
| Compound Name | 3-[(2S,5aS,8aS)-6-cyclohexyl-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 163050323 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 3-[(2S,5aS,8aS)-6-cyclohexyl-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-phenylpropanamide |
| SMILES | CN1[C@@H](CCC(=O)Nc2ccccc2)CNC(=O)[C@@H]2[C@@H]1CCN2C1CCCCC1 |
| InChI | InChI=1S/C23H34N4O2/c1-26-19(12-13-21(28)25-17-8-4-2-5-9-17)16-24-23(29)22-20(26)14-15-27(22)18-10-6-3-7-11-18/h2,4-5,8-9,18-20,22H,3,6-7,10-16H2,1H3,(H,24,29)(H,25,28)/t19-,20-,22-/m0/s1 |
| InChIKey | LIOQSNNYIURFNW-ONTIZHBOSA-N |
| XLogP | 2.61 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |