C24H40N4O4 — CID 75111944
methyl 1-[3-(6-cyclohexyl-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl)propanoyl]piperidine-4-carboxylate (PubChem CID 75111944) has the molecular formula C24H40N4O4 and a molecular weight of 448.61 g/mol. Its IUPAC name is methyl 1-[3-(6-cyclohexyl-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl)propanoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[3-(6-cyclohexyl-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl)propanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 75111944 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | methyl 1-[3-(6-cyclohexyl-1-methyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl)propanoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CCC2CNC(=O)C3C(CCN3C3CCCCC3)N2C)CC1 |
| InChI | InChI=1S/C24H40N4O4/c1-26-19(8-9-21(29)27-13-10-17(11-14-27)24(31)32-2)16-25-23(30)22-20(26)12-15-28(22)18-6-4-3-5-7-18/h17-20,22H,3-16H2,1-2H3,(H,25,30) |
| InChIKey | QRPQHNOJOOFTMP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |