C26H47N7O2 — CID 163126952
1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-6-(piperidin-2-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one (PubChem CID 163126952) has the molecular formula C26H47N7O2 and a molecular weight of 489.71 g/mol. Its IUPAC name is 1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-6-(piperidin-2-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | 1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-6-(piperidin-2-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 163126952 |
| Molecular Formula | C26H47N7O2 |
| Molecular Weight | 489.71 g/mol |
| Exact Mass | 489.38 |
| IUPAC Name | 1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-6-(piperidin-2-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
| SMILES | CN1C(CCC(=O)N2CCN(C3CCCCN3)CC2)CNC(=O)C2C1CCN2CC1CCCCN1 |
| InChI | InChI=1S/C26H47N7O2/c1-30-21(8-9-24(34)32-16-14-31(15-17-32)23-7-3-5-12-28-23)18-29-26(35)25-22(30)10-13-33(25)19-20-6-2-4-11-27-20/h20-23,25,27-28H,2-19H2,1H3,(H,29,35) |
| InChIKey | HUNZDMUKMVJXTE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.71 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |