C23H42N8O2S — CID 163139850
1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-6-(thiadiazolidin-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one (PubChem CID 163139850) has the molecular formula C23H42N8O2S and a molecular weight of 494.71 g/mol. Its IUPAC name is 1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-6-(thiadiazolidin-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | 1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-6-(thiadiazolidin-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 163139850 |
| Molecular Formula | C23H42N8O2S |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | 1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-6-(thiadiazolidin-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-5-one |
| SMILES | CN1C(CCC(=O)N2CCN(C3CCCCN3)CC2)CNC(=O)C2C1CCN2CC1CSNN1 |
| InChI | InChI=1S/C23H42N8O2S/c1-28-18(5-6-21(32)30-12-10-29(11-13-30)20-4-2-3-8-24-20)14-25-23(33)22-19(28)7-9-31(22)15-17-16-34-27-26-17/h17-20,22,24,26-27H,2-16H2,1H3,(H,25,33) |
| InChIKey | BLAXDUKLOFLTDJ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|