C20H36N6O2 — CID 163172253
1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-2,3,4,5a,6,7,8,8a-octahydropyrrolo[3,2-e][1,4]diazepin-5-one (PubChem CID 163172253) has the molecular formula C20H36N6O2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-2,3,4,5a,6,7,8,8a-octahydropyrrolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | 1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-2,3,4,5a,6,7,8,8a-octahydropyrrolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 163172253 |
| Molecular Formula | C20H36N6O2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 1-methyl-2-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-2,3,4,5a,6,7,8,8a-octahydropyrrolo[3,2-e][1,4]diazepin-5-one |
| SMILES | CN1C(CCC(=O)N2CCN(C3CCCCN3)CC2)CNC(=O)C2NCCC21 |
| InChI | InChI=1S/C20H36N6O2/c1-24-15(14-23-20(28)19-16(24)7-9-22-19)5-6-18(27)26-12-10-25(11-13-26)17-4-2-3-8-21-17/h15-17,19,21-22H,2-14H2,1H3,(H,23,28) |
| InChIKey | VKGHMJCJRAXHNY-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |