C18H26N4O2 — CID 45361054
3-[(2S,5aS,8aR)-1,6-dimethyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-phenylpropanamide (PubChem CID 45361054) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[(2S,5aS,8aR)-1,6-dimethyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-phenylpropanamide.
| Compound Name | 3-[(2S,5aS,8aR)-1,6-dimethyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 45361054 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 3-[(2S,5aS,8aR)-1,6-dimethyl-5-oxo-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]-N-phenylpropanamide |
| SMILES | CN1CC[C@@H]2[C@H]1C(=O)NC[C@H](CCC(=O)Nc1ccccc1)N2C |
| InChI | InChI=1S/C18H26N4O2/c1-21-11-10-15-17(21)18(24)19-12-14(22(15)2)8-9-16(23)20-13-6-4-3-5-7-13/h3-7,14-15,17H,8-12H2,1-2H3,(H,19,24)(H,20,23)/t14-,15+,17-/m0/s1 |
| InChIKey | AJKHZFCMUPNASK-UXLLHSPISA-N |
| XLogP | 0.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |